BIOPEP-UWM: Report
| ID | 2801 |
| Name | Peptide T |
| sequence |
| Function: | |||
| Inhibiting HIV receptor binding | |||
| Number of residues | 8 |
Activity code | avi |
| Activity : | antiviral |
|||
| Chemical mass | 857.8597 | Monoisotopic mass | 857.3753 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Pert C. B., Hill J. M., Ruff M. R., Berman R. M., Robey W. G., Arthur L. O., Ruscetti F. W., Farrar W. L. | |
| Title | |
| Octapeptides deduced from the neuropeptide receptor-like pattern of antigen T4 in brain potently inhibit human immunodeficiency virus receptor binding and T-cells infectivity. Proc. Natl Acad. Sci. USA, 83, 9254-9258, 1986 | |
| Year | Source |
| 1986 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(N)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])([C@@H](C)O)C(=O)N[C@@]([H])([C@@H](C)O)C(=O)N[C@@]([H])([C@@H](C)O)C(=O)N[C@@]([H])(CC(N)=O)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])([C@@H](C)O)C(O)=O InChI=1S/C35H55N9O16/c1-13(36)28(52)40-22(12-45)31(55)41-25(15(3)47)33(57)43-26(16(4)48)34(58)42-24(14(2)46)32(56)39-21(11-23(37)51)29(53)38-20(10-18-6-8-19(50)9-7-18)30(54)44-27(17(5)49)35(59)60/h6-9,13-17,20-22,24-27,45-50H,10-12,36H2,1-5H3,(H2,37,51)(H,38,53)(H,39,56)(H,40,52)(H,41,55)(H,42,58)(H,43,57)(H,44,54)(H,59,60)/t13-,14+,15+,16+,17+,20-,21-,22-,24-,25-,26-,27-/m0/s1 InChIKey=IWHCAJPPWOMXNW-LYKMMFCUSA-N Inhibits HIV receptor binding T-cells. |
| Database reference: |
| ACToR: ID 106362-32-7 BRENDA: Ligand Ala-Ser-Thr-Thr-Thr-Asn-Tyr-Thr ChEMBL: ID CHEMBL180971 ChemIDplus: ID 106362327 ChemSpider: ID 66081 FDA UNII: ID 05DYM3ZS1X HIPdb: ID HIP1064 J-GLOBAL: ID 200907094112459337 NIAID: ID 000530 Nikkaji: ID J501.338K PubChem: CID 73352 SATPdb: ID satpdb24052 SureChEMBL: ID SCHEMBL5813760 ZINC: ID ZINC000169345692 |