BIOPEP-UWM: Report
| ID | 2803 |
| Name | PEP inhibitor |
| sequence |
| Function: | |||
| Inhibitor of prolyl oligopeptidase (EC 3.4.21.26) (MEROPS ID: S09.001) | |||
| Number of residues | 6 |
Activity code | am |
| Activity : | antiamnestic |
|||
| Chemical mass | 658.7868 | Monoisotopic mass | 658.3791 | |
| IC50 : | 400.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Maruyama S., Miyoshi S., Osa T., Tanaka H. | |
| Title | |
| Prolyl endopeptidase inhibitory activity of peptides in the repeated sequence of various proline-rich proteins. J. Ferment. Bioeng.,74(3), 145-148, 1992 | |
| Year | Source |
| 1992 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N1CCC[C@@]1([H])C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(Cc1cnc[nH]1)C(O)=O InChI=1S/C32H50N8O7/c1-18(2)14-21(33)29(43)39-12-6-9-24(39)31(45)40-13-7-10-25(40)30(44)38-11-5-8-23(38)27(41)37-26(19(3)4)28(42)36-22(32(46)47)15-20-16-34-17-35-20/h16-19,21-26H,5-15,33H2,1-4H3,(H,34,35)(H,36,42)(H,37,41)(H,46,47)/t21-,22-,23-,24-,25-,26-/m0/s1 InChIKey=UJOYOAZXQXXPNK-FRSCJGFNSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database |
| Database reference: |
| AHTPDB: ID 5762 BioPepDB: ID biopep00853 SATPdb: ID satpdb23267 |