BIOPEP-UWM: Report
| ID | 2808 |
| Name | PEP inhibitor |
| sequence |
| Function: | |||
| Inhibitor of prolyl oligopeptidase (EC 3.4.21.26) (MEROPS ID: S09.001) | |||
| Number of residues | 6 |
Activity code | am |
| Activity : | antiamnestic |
|||
| Chemical mass | 654.8175 | Monoisotopic mass | 654.3399 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Maruyama S., Ohmori T., Nakagami T. | |
| Title | |
| Prolyl endopeptidase inhibitory activity of a glial fibrillary acidic protein fragment and other proline-rich peptides. Biosci. Biotech. Biochem. 60(2), 358-359, 1996 | |
| Year | Source |
| 1996 | Journal |
| Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCSC)C(=O)N[C@@]([H])([C@@H](C)O)C(=O)N1CCC[C@@]1([H])C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CC(C)C)C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C30H50N6O8S/c1-17(2)16-20(27(40)36-14-7-10-23(36)30(43)44)32-26(39)21-8-5-12-34(21)28(41)22-9-6-13-35(22)29(42)24(18(3)37)33-25(38)19(31)11-15-45-4/h17-24,37H,5-16,31H2,1-4H3,(H,32,39)(H,33,38)(H,43,44)/t18-,19+,20+,21+,22+,23+,24+/m1/s1 InChIKey=AOTACQZVAYOELL-CBUBZBNCSA-N |
| Database reference: |