BIOPEP-UWM: Report
| ID | 2809 |
| Name | PEP inhibitor |
| sequence |
| Function: | |||
| Inhibitor of prolyl oligopeptidase (EC 3.4.21.26) (MEROPS ID: S09.001) | |||
| Number of residues | 5 |
Activity code | am |
| Activity : | antiamnestic |
|||
| Chemical mass | 519.6320 | Monoisotopic mass | 519.3047 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Maruyama S., Ohmori T., Nakagami T. | |
| Title | |
| Prolyl endopeptidase inhibitory activity of a glial fibrillary acidic protein fragment and other proline-rich peptides. Biosci. Biotech. Biochem. 60 (2), 358-359, 1996 | |
| Year | Source |
| 1996 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CC(C)C)(NC(=O)[C@]1([H])CCCN1C(=O)[C@]1([H])CCCN1C(=O)[C@]1([H])CCCN1)C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C26H41N5O6/c1-16(2)15-18(24(34)31-14-6-10-21(31)26(36)37)28-22(32)19-8-4-12-29(19)25(35)20-9-5-13-30(20)23(33)17-7-3-11-27-17/h16-21,27H,3-15H2,1-2H3,(H,28,32)(H,36,37)/t17-,18-,19-,20-,21-/m0/s1 InChIKey=WLTCJERABISHCU-SXYSDOLCSA-N |
| Database reference: |