BIOPEP-UWM: Report
| ID | 2810 |
| Name | PEP inhibitor |
| sequence |
| Function: | |||
| Inhibitor of prolyl oligopeptidase (EC 3.4.21.26) (MEROPS ID: S09.001) | |||
| Number of residues | 6 |
Activity code | am |
| Activity : | antiamnestic |
|||
| Chemical mass | 650.8288 | Monoisotopic mass | 650.3450 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Maruyama S., Ohmori T., Nakagami T. | |
| Title | |
| Prolyl endopeptidase inhibitory activity of a glial fibrillary acidic protein fragment and other proline-rich peptides. Biosci. Biotech. Biochem. 60 (2), 358-359, 1996 | |
| Year | Source |
| 1996 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCSC)C(=O)N1CCC[C@@]1([H])C(=O)N1CCC[C@@]1([H])C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CC(C)C)C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C31H50N6O7S/c1-19(2)18-21(28(40)37-16-7-11-25(37)31(43)44)33-26(38)22-8-4-13-34(22)29(41)24-10-6-15-36(24)30(42)23-9-5-14-35(23)27(39)20(32)12-17-45-3/h19-25H,4-18,32H2,1-3H3,(H,33,38)(H,43,44)/t20-,21-,22-,23-,24-,25-/m0/s1 InChIKey=GMQBMCZIADIULZ-OOPVGHQCSA-N |
| Database reference: |