BIOPEP-UWM: Report
| ID | 2811 |
| Name | PEP inhibitor |
| sequence |
| Function: | |||
| Inhibitor of prolyl oligopeptidase (EC 3.4.21.26) (MEROPS ID: S09.001) | |||
| Number of residues | 4 |
Activity code | am |
| Activity : | antiamnestic |
|||
| Chemical mass | 464.5570 | Monoisotopic mass | 464.2739 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Maruyama S., Miyoshi S., Osa T., Tanaka H. | |
| Title | |
| Prolyl endopeptidase inhibitory activity of peptides in the repeated sequence of various proline-rich proteins. J. Ferm. Bioengineering, 74 (3) ,145-148, 1992 | |
| Year | Source |
| 1992 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CC(C)C)(NC(=O)[C@]([H])(CC1=CN=CN1)NC(=O)[C@@]([H])(N)C(C)C)C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C22H36N6O5/c1-12(2)8-16(21(31)28-7-5-6-17(28)22(32)33)27-19(29)15(9-14-10-24-11-25-14)26-20(30)18(23)13(3)4/h10-13,15-18H,5-9,23H2,1-4H3,(H,24,25)(H,26,30)(H,27,29)(H,32,33)/t15-,16-,17-,18-/m0/s1 InChIKey=NUYZZWNYPQMNEY-XSLAGTTESA-N |
| Database reference: |
| ChemSpider: ID 16731064 |