BIOPEP-UWM: Report
| ID | 2812 |
| Name | PEP inhibitor |
| sequence |
| Function: | |||
| Inhibitor of prolyl oligopeptidase (EC 3.4.21.26) (MEROPS ID: S09.001) | |||
| Number of residues | 5 |
Activity code | am |
| Activity : | antiamnestic |
|||
| Chemical mass | 521.6478 | Monoisotopic mass | 521.3203 | |
| EC50 : | 500.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Maruyama S., Miyoshi S., Osa T., Tanaka H. | |
| Title | |
| Prolyl endopeptidase inhibitory activity of peptides in the repeated sequence of various proline-rich proteins. J. Ferm. Bioengineering, 74 (3) ,145-148, 1992 | |
| Year | Source |
| 1992 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N1CCC[C@@]1([H])C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(C(C)C)C(O)=O InChI=1S/C26H43N5O6/c1-15(2)14-17(27)23(33)30-12-6-9-19(30)25(35)31-13-7-10-20(31)24(34)29-11-5-8-18(29)22(32)28-21(16(3)4)26(36)37/h15-21H,5-14,27H2,1-4H3,(H,28,32)(H,36,37)/t17-,18-,19-,20-,21-/m0/s1 InChIKey=NDITUYCWBHVTPO-SXYSDOLCSA-N |
| Database reference: |