BIOPEP-UWM: Report
| ID | 2819 |
| Name | PEP inhibitor |
| sequence |
| Function: | |||
| Inhibitor of prolyl oligopeptidase (EC 3.4.21.26) (MEROPS ID: S09.001) | |||
| Number of residues | 11 |
Activity code | am |
| Activity : | antiamnestic |
|||
| Chemical mass | 1287.4256 | Monoisotopic mass | 1286.6614 | |
| EC50 : | 400.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Maruyama S., Miyoshi S., Osa T., Tanaka H. | |
| Title | |
| Prolyl endopeptidase inhibitory activity of peptides in the repeated sequence of various proline-rich proteins. J. Ferment. Bioeng.,74(3), 145-148, 1992 | |
| Year | Source |
| 1992 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CCCNC(N)=N)(NC(=O)[C@]1([H])CCCN1)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CCC(N)=O)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CC1=CN=CN1)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CCC(N)=O)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CC1=CN=CN1)C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C58H86N20O14/c59-45(79)17-15-36(70-48(82)40-10-3-21-74(40)52(86)35(9-2-20-66-58(61)62)69-47(81)34-8-1-19-65-34)53(87)75-22-4-12-42(75)50(84)72-38(26-32-28-63-30-67-32)55(89)77-24-6-11-41(77)49(83)71-37(16-18-46(60)80)54(88)76-23-5-13-43(76)51(85)73-39(27-33-29-64-31-68-33)56(90)78-25-7-14-44(78)57(91)92/h28-31,34-44,65H,1-27H2,(H2,59,79)(H2,60,80)(H,63,67)(H,64,68)(H,69,81)(H,70,82)(H,71,83)(H,72,84)(H,73,85)(H,91,92)(H4,61,62,66)/t34-,35-,36-,37-,38-,39-,40-,41-,42-,43-,44-/m0/s1 InChIKey=DMLVKRDZXUGTDF-UZNCLCIMSA-N |
| Database reference: |