BIOPEP-UWM: Report
| ID | 2821 |
| Name | PEP inhibitor |
| sequence |
| Function: | |||
| Inhibitor of prolyl oligopeptidase (EC 3.4.21.26) (MEROPS ID: S09.001) | |||
| Number of residues | 4 |
Activity code | am |
| Activity : | antiamnestic |
|||
| Chemical mass | 412.4793 | Monoisotopic mass | 412.2314 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Maruyama S., Miyoshi S., Osa T., Tanaka H. | |
| Title | |
| Prolyl endopeptidase inhibitory activity of peptides in the repeated sequence of various proline-rich proteins. J. Ferment. Bioeng.,74(3), 145-148, 1992 | |
| Year | Source |
| 1992 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)([C@@H](C)O)C(=O)N1CCC[C@@]1([H])C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(C(C)C)C(O)=O InChI=1S/C19H32N4O6/c1-10(2)15(19(28)29)21-16(25)12-6-4-8-22(12)17(26)13-7-5-9-23(13)18(27)14(20)11(3)24/h10-15,24H,4-9,20H2,1-3H3,(H,21,25)(H,28,29)/t11-,12+,13+,14+,15+/m1/s1 InChIKey=WGBCZMNHJBIFPM-QTVXIADOSA-N |
| Database reference: |