BIOPEP-UWM: Report
| ID | 2825 |
| Name | PEP inhibitor |
| sequence |
| Function: | |||
| Inhibitor of prolyl oligopeptidase (EC 3.4.21.26) (MEROPS ID: S09.001) | |||
| Number of residues | 10 |
Activity code | am |
| Activity : | antiamnestic |
|||
| Chemical mass | 1011.2539 | Monoisotopic mass | 1010.6145 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Maruyama S., Ohmori T., Nakagami T. | |
| Title | |
| Prolyl endopeptidase inhibitory activity of a glial fibrillary acidic protein fragment and other proline-rich peptides. Biosci. Biotech. Biochem., 60(2), 358-359, 1996 | |
| Year | Source |
| 1996 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N1CCC[C@@]1([H])C(=O)N1CCC[C@@]1([H])C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CC(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C)C(O)=O InChI=1S/C51H82N10O11/c1-29(2)26-33(52)45(65)58-22-10-16-38(58)49(69)61-25-13-19-41(61)50(70)60-24-12-18-40(60)48(68)57-21-9-15-37(57)44(64)55-35(28-31(5)6)46(66)59-23-11-17-39(59)47(67)56-20-8-14-36(56)43(63)54-34(27-30(3)4)42(62)53-32(7)51(71)72/h29-41H,8-28,52H2,1-7H3,(H,53,62)(H,54,63)(H,55,64)(H,71,72)/t32-,33-,34-,35-,36-,37-,38-,39-,40-,41-/m0/s1 InChIKey=SUTJVPCWDIBGNL-CJSHHNLHSA-N |
| Database reference: |