BIOPEP-UWM: Report
| ID | 2826 |
| Name | PEP inhibitor |
| sequence |
| Function: | |||
| Inhibitor of prolyl oligopeptidase (EC 3.4.21.26) (MEROPS ID: S09.001) | |||
| Number of residues | 10 |
Activity code | am |
| Activity : | antiamnestic |
|||
| Chemical mass | 1017.2399 | Monoisotopic mass | 1016.5347 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Maruyama S., Ohmori T., Nakagami T. | |
| Title | |
| Prolyl endopeptidase inhibitory activity of a glial fibrillary acidic protein fragment and other proline-rich peptides. Biosci. Biotech. Biochem., 60(2), 358-359, 1996 | |
| Year | Source |
| 1996 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCSC)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C48H76N10O12S/c1-27(2)26-31(44(65)56-22-9-15-35(56)47(68)58-24-11-17-37(58)48(69)70)51-39(60)32-12-7-20-54(32)45(66)36-16-10-23-57(36)46(67)34-14-8-21-55(34)43(64)30(18-25-71-5)50-41(62)38(29(4)59)52-40(61)33-13-6-19-53(33)42(63)28(3)49/h27-38,59H,6-26,49H2,1-5H3,(H,50,62)(H,51,60)(H,52,61)(H,69,70)/t28-,29+,30-,31-,32-,33-,34-,35-,36-,37-,38-/m0/s1 InChIKey: YGLIYWQYCCXGRY-WQTGZOFISA-N |
| Database reference: |