BIOPEP-UWM: Report
| ID | 2827 |
| Name | PEP inhibitor |
| sequence |
| Function: | |||
| Inhibitor of prolyl oligopeptidase (EC 3.4.21.26) (MEROPS ID: S09.001) | |||
| Number of residues | 7 |
Activity code | am |
| Activity : | antiamnestic |
|||
| Chemical mass | 721.9065 | Monoisotopic mass | 721.3820 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Maruyama S., Ohmori T., Nakagami T. | |
| Title | |
| Prolyl endopeptidase inhibitory activity of a glial fibrillary acidic protein fragment and other proline-rich peptides. Biosci. Biotech. Biochem., 60(2), 358-359, 1996 | |
| Year | Source |
| 1996 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCSC)C(=O)N1CCC[C@@]1([H])C(=O)N1CCC[C@@]1([H])C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CC(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(C)C(O)=O InChI=1S/C34H55N7O8S/c1-20(2)19-23(31(45)38-14-5-9-24(38)28(42)36-21(3)34(48)49)37-29(43)25-10-6-15-39(25)32(46)27-12-8-17-41(27)33(47)26-11-7-16-40(26)30(44)22(35)13-18-50-4/h20-27H,5-19,35H2,1-4H3,(H,36,42)(H,37,43)(H,48,49)/t21-,22-,23-,24-,25-,26-,27-/m0/s1 InChIKey=GXXAHCSRRWWLQU-DUJSLOSMSA-N |
| Database reference: |