BIOPEP-UWM: Report
| ID | 2834 |
| Name | papain inhibitor |
| sequence |
| Function: | |||
| Inhibitor of papain (EC 3.4.22.2) (MEROPS ID: C01.001) | |||
| Number of residues | 4 |
Activity code | inh |
| Activity : | inhibitor |
|||
| Chemical mass | 451.4757 | Monoisotopic mass | 451.2173 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Funk M. O., Nakagawa Y., Skochdopole J., Kaiser T. | |
| Title | |
| Affinity chromatographic purification of papain. Int. J. Pept. Prot. Res., 13, 296-303, 1979 | |
| Year | Source |
| 1979 | Journal |
| Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CCCNC(N)=N)(NC(=O)[C@]([H])(Cc1ccc(O)cc1)NC(=O)CNC(=O)CN)C(O)=O InChI=1S/C19H29N7O6/c20-9-15(28)24-10-16(29)25-14(8-11-3-5-12(27)6-4-11)17(30)26-13(18(31)32)2-1-7-23-19(21)22/h3-6,13-14,27H,1-2,7-10,20H2,(H,24,28)(H,25,29)(H,26,30)(H,31,32)(H4,21,22,23)/t13-,14-/m0/s1 InChIKey=FJPHHBGPPJXISY-KBPBESRZSA-N |
| Database reference: |
| BRENDA: Ligand Gly-Gly-Tyr-Arg ChemIDplus: ID 070195209 ChemSpider: ID 111901 PubChem: CID 125825 |