BIOPEP-UWM: Report
| ID | 2835 |
| Name | Renin inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Renin (EC 3.4.23.15) (MEROPS ID A01.007) | |||
| Number of residues | 2 |
Activity code | ren |
| Activity : | renin inhibitor |
|||
| Chemical mass | 266.2923 | Monoisotopic mass | 266.1262 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Udenigwe C.; Li H.; Aluko R. | |
| Title | |
| Quantitative structure-activity relationship modeling of renin-inhibiting dipeptides. Amino Acids, 42, 1379–1386, 2012 | |
| Year | Source |
| 2012 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)O InChI=1S/C13H18N2O4/c1-8(16)11(13(18)19)15-12(17)10(14)7-9-5-3-2-4-6-9/h2-6,8,10-11,16H,7,14H2,1H3,(H,15,17)(H,18,19)/t8-,10+,11+/m1/s1 InChIKey: NYQBYASWHVRESG-MIMYLULJSA-N |
| Database reference: |
| BRENDA: Ligand Phe-Thr ChEBI: ID 73636 ChemSpider: ID 8621027 Metabolights: ID MTBLC73636 PubChem: CID 10445608 SureChEMBL: ID SCHEMBL8525812 |