BIOPEP-UWM: Report
| ID | 2861 |
| Name | fragment of human alpha s1-casein |
| sequence |
| Function: | |||
| Opioid | |||
| Number of residues | 5 |
Activity code | op |
| Activity : | opioid |
|||
| Chemical mass | 621.7221 | Monoisotopic mass | 621.3152 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kampa M., Loukas S., Hatzoglou A., Martin P., Castinas E. | |
| Title | |
| Identification of a novel opioid peptide (Tyr-Val-Pro-Phe-Pro) derived from human alpha s1-casein (alpha s1-casomorphin and alpha s1-casomorphin amide). Biochem. J., 319, 903-908, 1996 | |
| Year | Source |
| 1996 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(C(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C33H43N5O7/c1-20(2)28(36-29(40)24(34)18-22-12-14-23(39)15-13-22)32(43)37-16-6-10-26(37)30(41)35-25(19-21-8-4-3-5-9-21)31(42)38-17-7-11-27(38)33(44)45/h3-5,8-9,12-15,20,24-28,39H,6-7,10-11,16-19,34H2,1-2H3,(H,35,41)(H,36,40)(H,44,45)/t24-,25-,26-,27-,28-/m0/s1 InChIKey=XPSCPPWMEMHJKP-XLIKFSOKSA-N Anticancer peptide according to the BIOPEP-UWM database of bioactive peptides (ID 9275), the MBPDB database |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9275 ChemSpider: ID 8591867 DFBP: ID DFBPOPIO0038 EROP-Moscow: ID E10356 MBPDB: peptide YVPFP PepBank: peptide YVPFP PubChem: CID 10416434 |