BIOPEP-UWM: Report
| ID | 2863 |
| Name | Opioid peptide |
| sequence |
| Function: | |||
| Opioid agonist | |||
| Number of residues | 6 |
Activity code | op1 |
| Activity : | opioid agonist |
|||
| Chemical mass | 750.8358 | Monoisotopic mass | 750.3576 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yoshikawa M., Yoshimura T., Chiba H. | |
| Title | |
| Opioid peptides in human beta-casein. Agricultural and Biological Chemistry, 48, 3185-3187, 1984 | |
| Year | Source |
| 1984 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(Cc1ccc(O)cc1)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(O)=O)C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C38H50N6O10/c1-22(2)32(35(50)40-27(16-17-31(46)47)37(52)44-19-7-11-30(44)38(53)54)42-33(48)28(21-23-8-4-3-5-9-23)41-34(49)29-10-6-18-43(29)36(51)26(39)20-24-12-14-25(45)15-13-24/h3-5,8-9,12-15,22,26-30,32,45H,6-7,10-11,16-21,39H2,1-2H3,(H,40,50)(H,41,49)(H,42,48)(H,46,47)(H,53,54)/t26-,27-,28-,29-,30-,32-/m0/s1 InChIKey=WUHXJZCLFYNVBB-RUAREOIKSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides (ID 10084) Antioxidative peptides according to the BIOPEP-UWM database of bioactive peptides (ID 10083) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 10083; 10084 ChEBI: ID 149640 ChemSpider: ID 88294636 EROP-Moscow: ID E14513 FeptideDB: ID 2863 MBPDB: Peptide YPFVEP PubChem: CID13711947 RHEA: ID 63568 |