BIOPEP-UWM: Report
ID | 2864 |
Name | beta-Casomorphin 4 (human) |
sequence |
Function: | |||
Opioid | |||
Number of residues | 4 |
Activity code | op1 |
Activity : | opioid agonist |
|||
Chemical mass | 524.6072 | Monoisotopic mass | 524.2626 | |
EC50 : | 0.00 µM |
Bibliographic data: | |
Authors | |
Brantl V. | |
Title | |
Novel opioid peptides derived from human beta-casein: Human beta-casomorphins. European Journal of Pharmacology, 106, 213-214, 1984 | |
Year | Source |
1984 | Journal |
Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(Cc1ccc(O)cc1)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(C(C)C)C(O)=O InChI=1S/C28H36N4O6/c1-17(2)24(28(37)38)31-25(34)22(16-18-7-4-3-5-8-18)30-26(35)23-9-6-14-32(23)27(36)21(29)15-19-10-12-20(33)13-11-19/h3-5,7-8,10-13,17,21-24,33H,6,9,14-16,29H2,1-2H3,(H,30,35)(H,31,34)(H,37,38)/t21-,22-,23-,24-/m0/s1 InChIKey=AXLIEWKGJFHSLA-ZJZGAYNASA-N |
Database reference: |
ChemSpider: ID 8273855 EROP-Moscow: ID E00536 J-GLOBAL: ID 200907056656540465 Nikkaji: ID J39.393B PubChem: CID 10098321 |