BIOPEP-UWM: Report
ID | 2865 |
Name | Human beta casomorphin 8 |
sequence |
Function: | |||
Opioid | |||
Number of residues | 8 |
Activity code | op1 |
Activity : | opioid agonist |
|||
Chemical mass | 961.1079 | Monoisotopic mass | 960.4940 | |
EC50 : | 0.00 µM |
Bibliographic data: | |
Authors | |
Yoshikawa M, Yoshimura T, Chiba H. | |
Title | |
Opioid peptides in human beta-casein. Agricultural and Biological Chemistry, 48, 3185-3187, 1984 | |
Year | Source |
1984 | Journal |
Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(Cc1ccc(O)cc1)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(O)=O)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])([C@@H](C)CC)C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C49H68N8O12/c1-5-29(4)41(48(67)57-25-11-16-38(57)49(68)69)54-44(63)37-15-10-24-56(37)47(66)34(21-22-39(59)60)51-45(64)40(28(2)3)53-42(61)35(27-30-12-7-6-8-13-30)52-43(62)36-14-9-23-55(36)46(65)33(50)26-31-17-19-32(58)20-18-31/h6-8,12-13,17-20,28-29,33-38,40-41,58H,5,9-11,14-16,21-27,50H2,1-4H3,(H,51,64)(H,52,62)(H,53,61)(H,54,63)(H,59,60)(H,68,69)/t29-,33-,34-,35-,36-,37-,38-,40-,41-/m0/s1 InChIKey=GBYIGSOSWSECBF-RZTACLFWSA-N |
Database reference: |
ChemIDplus: ID 095210756 ChemSpider: ID 111508 EROP-Moscow: ID E14514; E03753 J-GLOBAL: ID 200907005085240490 Nikkaji: ID J39.400I PubChem: CID 125288 |