BIOPEP-UWM: Report
| ID | 2867 |
| Name | Human beta-casomorphin 5 |
| sequence |
| Function: | |||
| Opioid | |||
| Number of residues | 5 |
Activity code | op1 |
| Activity : | opioid agonist |
|||
| Chemical mass | 653.7209 | Monoisotopic mass | 653.3050 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Brantl V. | |
| Title | |
| Novel opioid peptides derived from human beta-casein: Human beta-casomorphins. European Journal of Pharmacology, 106, 213-214, 1984 | |
| Year | Source |
| 1984 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(Cc1ccc(O)cc1)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(O)=O)C(O)=O InChI=1S/C33H43N5O9/c1-19(2)28(31(44)35-24(33(46)47)14-15-27(40)41)37-29(42)25(18-20-7-4-3-5-8-20)36-30(43)26-9-6-16-38(26)32(45)23(34)17-21-10-12-22(39)13-11-21/h3-5,7-8,10-13,19,23-26,28,39H,6,9,14-18,34H2,1-2H3,(H,35,44)(H,36,43)(H,37,42)(H,40,41)(H,46,47)/t23-,24-,25-,26-,28-/m0/s1 InChIKey=LWTFUVBYCOGPPK-MGAMHGSISA-N Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides (ID 10075); the MBPDB database Peptide stimulating mucin secretion according to the BIOPEP-UWM database of bioactive peptides (ID 10077) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 10075; 10077 ChemSpider: ID 8614687 EROP-Moscow: ID E00535 FeptideDB: ID 2867 J-GLOBAL: ID 200907005161615082 MBPDB: Peptide YPFVE Nikkaji: ID J39.395I PubChem: CID 10439266 |