BIOPEP-UWM: Report
| ID | 2871 |
| Name | Melanotropin potentiating peptide |
| sequence |
| Function: | |||
| Melanocyte stimulating | |||
| Number of residues | 4 |
Activity code | sti |
| Activity : | stimulating |
|||
| Chemical mass | 460.5237 | Monoisotopic mass | 460.2637 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Carter R. J., Shuster S., Morley J. S. | |
| Title | |
| Melanotropin potentiating factor is the C-terminal tetrapeptide of human beta-lipotropin. Nature, 279, 74-75, 1979 | |
| Year | Source |
| 1979 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)NCC(=O)N[C@@]([H])(CCC(O)=O)C(O)=O InChI=1S/C19H36N6O7/c20-9-3-1-5-12(22)17(29)25-13(6-2-4-10-21)18(30)23-11-15(26)24-14(19(31)32)7-8-16(27)28/h12-14H,1-11,20-22H2,(H,23,30)(H,24,26)(H,25,29)(H,27,28)(H,31,32)/t12-,13-,14-/m0/s1 InChIKey=SUQWGICKJIJKNO-IHRRRGAJSA-N |
| Database reference: |
| ChemIDplus: ID 072189845 ChemSpider: ID 112309 J-GLOBAL: ID 200907072277400686 Nikkaji: ID J403.246B PubChem: CID 126368 |