BIOPEP-UWM: Report
ID | 2890 |
Name | neuropeptide |
sequence |
Function: | |||
neuropeptide | |||
Number of residues | 2 |
Activity code | ne |
Activity : | neuropeptide |
|||
Chemical mass | 203.1953 | Monoisotopic mass | 203.0903 | |
EC50 : | 0.00 µM |
Bibliographic data: | |
Authors | |
Parish D. C., Smyth D. G., Normanton J. R., Wolstencroft J. H. | |
Title | |
Glycyl glutamine, an inhibitory neuropeptide derived from beta-endorphin. Nature, 306, 267-270, 1983 | |
Year | Source |
1983 | Journal |
Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C7H13N3O4/c8-3-6(12)10-4(7(13)14)1-2-5(9)11/h4H,1-3,8H2,(H2,9,11)(H,10,12)(H,13,14)/t4-/m0/s1 InChIKey: PNMUAGGSDZXTHX-BYPYZUCNSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the BindingDB database; the BIOPEP-UWM database of bioactive peptides (ID 7610); the BRENDA database; the ChEMBL database; the EROP-Moscow database |
Database reference: |
ACToR: ID 13115-71-4 AHTPDB: ID 1431, 1450, 1997, 2994, 3068, 3243, 3490, 3560, 3818, a3932, 4405, 4524, 4701, 6596 BindingDB: ID 50407463 BioCyc: ID CPD-13394 BioPepDB: ID biopep00405 BIOPEP-UWM database of bioactive peptides: ID 7610 BRENDA: Ligand Gly-L-Gln ChEBI: ID 74392 ChEMBL: ID CHEMBL330038 ChemIDplus: ID 013115714 ChemSpider: ID 110444 ECHA: Compound (2S)-5-amino-2-[(aminoacetyl)amino]-5-oxopentanoic acid EPA CompTox: ID DTXSID20156917 EPA DSSTox: ID DTXCID7079408 EROP-Moscow: ID E09225 FDA SRS: ID H7125Z98HT J-GLOBAL: ID 200907086539149883 Metabolights: ID MTBLC74392 Nikkaji: ID J367.005H NMRShiftDB: ID 20208822 PubChem: CID 123913 Rhea: ID 74392 SATPdb: ID satpdb26133 SDBS: ID 19325 SureChEMBL: ID SCHEMBL150160 ZINC: ID ZINC000002555108 |