BIOPEP-UWM: Report
| ID | 2905 |
| Name | Precursor of neuropeptide |
| sequence |
| Function: | |||
| Precursor of neuropeptide | |||
| Number of residues | 11 |
Activity code | ne |
| Activity : | neuropeptide |
|||
| Chemical mass | 1301.4933 | Monoisotopic mass | 1300.7343 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Sithigorngul P., Saraithongkum W., Jaideechoey S., Longyant S., Sithigorngul W. | |
| Title | |
| Novel FMRFamide-like neuropeptides from the eyestalk of the giant prawn Macrobrachium rosenbergii. Comp. Biochem. Physiol. B, 120, 587-595 (1998) | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(O)=O)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])([C@@H](C)O)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)NCC(O)=O InChI=1S/C57H96N20O15/c1-29(2)24-38(73-45(83)31(5)69-53(91)41-19-13-23-77(41)54(92)44(32(6)78)76-50(88)37(18-12-22-67-57(63)64)70-46(84)34(58)27-42(79)80)51(89)71-35(16-10-20-65-55(59)60)48(86)74-39(25-30(3)4)52(90)72-36(17-11-21-66-56(61)62)49(87)75-40(47(85)68-28-43(81)82)26-33-14-8-7-9-15-33/h7-9,14-15,29-32,34-41,44,78H,10-13,16-28,58H2,1-6H3,(H,68,85)(H,69,91)(H,70,84)(H,71,89)(H,72,90)(H,73,83)(H,74,86)(H,75,87)(H,76,88)(H,79,80)(H,81,82)(H4,59,60,65)(H4,61,62,66)(H4,63,64,67)/t31-,32+,34-,35-,36-,37-,38-,39-,40-,41-,44-/m0/s1 InChIKey=VSOKWCKAKDENED-NBHIJXKISA-N The active form is C-terminal amide group instead of C-terminal glycine residue. Peptide is the precursor of neuropeptide (ID 2924 in BIOPEP-UWM database of bioactive peptides). Reviews concerning C-terminal amidation of peptides: Bradbury A. F., Smyth D. G., 1991, Peptide amidation. Trends Biochem. Sci., 16, 112-115 Merkler D. J., 1994, C-terminal amidated peptides: production by the in vitro enzymatic amidation of glycine-extended peptides and the importance of the amide to bioactivity. Enzyme Microb. Technol., 16, 450-456 |
| Database reference: |