BIOPEP-UWM: Report
| ID | 2914 |
| Name | Precursor of neuropeptide |
| sequence |
| Function: | |||
| Precursor of neuropeptide | |||
| Number of residues | 8 |
Activity code | ne |
| Activity : | neuropeptide |
|||
| Chemical mass | 1023.1458 | Monoisotopic mass | 1022.5395 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mercier A. J., Orchard I., Tebrugge V., Skerrett M. | |
| Title | |
| Isolation of two FMRFamide-related peptides from crayfish pericardial organs. Peptides, 14, 137-143, 1993 | |
| Year | Source |
| 1993 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(N)=O)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(CC(N)=O)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)NCC(O)=O InChI=1S/C46H70N16O11/c1-25(2)19-31(42(71)58-30(16-10-18-55-46(52)53)41(70)60-32(39(68)56-24-37(65)66)20-26-11-5-3-6-12-26)59-43(72)33(21-27-13-7-4-8-14-27)61-44(73)34(23-36(49)64)62-40(69)29(15-9-17-54-45(50)51)57-38(67)28(47)22-35(48)63/h3-8,11-14,25,28-34H,9-10,15-24,47H2,1-2H3,(H2,48,63)(H2,49,64)(H,56,68)(H,57,67)(H,58,71)(H,59,72)(H,60,70)(H,61,73)(H,62,69)(H,65,66)(H4,50,51,54)(H4,52,53,55)/t28-,29-,30-,31-,32-,33-,34-/m0/s1 InChIKey=OLUGBBVXZBYNNO-NXBWRCJVSA-N The active form is C-terminal amide group instead of C-terminal glycine residue. Peptide is the precursor of neuropeptide (ID 2894 in BIOPEP-UWM database of bioactive peptides). Reviews concerning C-terminal amidation of peptides: Bradbury A. F., Smyth D. G., 1991, Peptide amidation. Trends Biochem. Sci., 16, 112-115 Merkler D. J., 1994, C-terminal amidated peptides: production by the in vitro enzymatic amidation of glycine-extended peptides and the importance of the amide to bioactivity. Enzyme Microb. Technol., 16, 450-456 |
| Database reference: |