BIOPEP-UWM: Report
| ID | 2915 |
| Name | Precursor of neuropeptide |
| sequence |
| Function: | |||
| CFBPPEGVURWIFU-AQJXLSMYSA-N | |||
| Number of residues | 10 |
Activity code | ne |
| Activity : | neuropeptide |
|||
| Chemical mass | 1216.3446 | Monoisotopic mass | 1215.6131 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Krajniak K.G. | |
| Title | |
| The identification and structure-activity relations of a cardioactive FMRFamide-related peptide from the blue crab Callinectes sapidus. Peptides, 12, 1295-1302, 1991 | |
| Year | Source |
| 1991 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)NCC(=O)O InChI=1S/C56H81N17O14/c1-31(2)23-38(50(83)67-36(15-9-21-63-55(59)60)48(81)70-39(47(80)65-29-46(78)79)24-32-11-5-3-6-12-32)69-52(85)41(25-33-13-7-4-8-14-33)71-54(87)43(30-74)73-49(82)37(16-10-22-64-56(61)62)68-53(86)42(27-44(58)76)72-51(84)40(66-45(77)28-57)26-34-17-19-35(75)20-18-34/h3-8,11-14,17-20,31,36-43,74-75H,9-10,15-16,21-30,57H2,1-2H3,(H2,58,76)(H,65,80)(H,66,77)(H,67,83)(H,68,86)(H,69,85)(H,70,81)(H,71,87)(H,72,84)(H,73,82)(H,78,79)(H4,59,60,63)(H4,61,62,64)/t36-,37-,38-,39-,40-,41-,42-,43-/m0/s1 InChIKey: CFBPPEGVURWIFU-AQJXLSMYSA-N The active form is C-terminal amide group instead of C-terminal glycine residue. Peptide is the precursor of neuropeptide (ID 2892 in BIOPEP-UWM database of bioactive peptides). Reviews concerning C-terminal amidation of peptides: Bradbury A. F., Smyth D. G., 1991, Peptide amidation. Trends Biochem. Sci., 16, 112-115 Merkler D. J., 1994, C-terminal amidated peptides: production by the in vitro enzymatic amidation of glycine-extended peptides and the importance of the amide to bioactivity. Enzyme Microb. Technol., 16, 450-456 |
| Database reference: |