BIOPEP-UWM: Report
| ID | 2918 |
| Name | Precursor of neuropeptide |
| sequence |
| Function: | |||
| Precursor of neuropeptide | |||
| Number of residues | 8 |
Activity code | ne |
| Activity : | neuropeptide |
|||
| Chemical mass | 1010.1437 | Monoisotopic mass | 1009.5329 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Cowden C., Stretton A. O. W., Davis R. E. | |
| Title | |
| AF1, a sequenced bioactive neuropeptide isolated from the nematode Ascaris suum. Neuron, 2, 1465-1473, 1989 | |
| Year | Source |
| 1989 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCCN)C(=O)N[C@@]([H])(CC(N)=O)C(=O)N[C@@]([H])(CCC(O)=O)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])([C@@H](C)CC)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)NCC(O)=O InChI=1S/C47H71N13O12/c1-3-27(2)39(46(72)56-31(18-12-22-53-47(51)52)42(68)58-33(41(67)54-26-38(64)65)23-28-13-6-4-7-14-28)60-45(71)34(24-29-15-8-5-9-16-29)59-43(69)32(19-20-37(62)63)55-44(70)35(25-36(50)61)57-40(66)30(49)17-10-11-21-48/h4-9,13-16,27,30-35,39H,3,10-12,17-26,48-49H2,1-2H3,(H2,50,61)(H,54,67)(H,55,70)(H,56,72)(H,57,66)(H,58,68)(H,59,69)(H,60,71)(H,62,63)(H,64,65)(H4,51,52,53)/t27-,30-,31-,32-,33-,34-,35-,39-/m0/s1 InChIKey=PIYMYMSHHQPHSV-SLHGWXJASA-N The active form is C-terminal amide group instead of C-terminal glycine residue. Peptide is the precursor of neuropeptide (ID 2896 in BIOPEP-UWM database of bioactive peptides). Reviews concerning C-terminal amidation of peptides: Bradbury A. F., Smyth D. G., 1991, Peptide amidation. Trends Biochem. Sci., 16, 112-115 Merkler D. J., 1994, C-terminal amidated peptides: production by the in vitro enzymatic amidation of glycine-extended peptides and the importance of the amide to bioactivity. Enzyme Microb. Technol., 16, 450-456 |
| Database reference: |