BIOPEP-UWM: Report
| ID | 2919 |
| Name | Precursor of neuropeptide |
| sequence |
| Function: | |||
| Neuropeptide precursor | |||
| Number of residues | 5 |
Activity code | ne |
| Activity : | neuropeptide |
|||
| Chemical mass | 656.7954 | Monoisotopic mass | 656.3095 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Price D. A., Greenberg M. Y. | |
| Title | |
| Structure of a molluscan cardioexitatory neuropeptide. Science, 197, 670-671, 1977 | |
| Year | Source |
| 1977 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(Cc1ccccc1)C(=O)N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)NCC(O)=O InChI=1S/C31H44N8O6S/c1-46-16-14-24(37-27(42)22(32)17-20-9-4-2-5-10-20)30(45)38-23(13-8-15-35-31(33)34)29(44)39-25(28(43)36-19-26(40)41)18-21-11-6-3-7-12-21/h2-7,9-12,22-25H,8,13-19,32H2,1H3,(H,36,43)(H,37,42)(H,38,45)(H,39,44)(H,40,41)(H4,33,34,35)/t22-,23-,24-,25-/m0/s1 InChIKey=IHQYPJSVAKOOST-QORCZRPOSA-N The active form is C-terminal amide group instead of C-terminal glycine residue. Peptide is the precursor of neuropeptide (ID 2893 in BIOPEP-UWM database of bioactive peptides). Reviews concerning C-terminal amidation of peptides: Bradbury A. F., Smyth D. G., 1991, Peptide amidation. Trends Biochem. Sci., 16, 112-115 Merkler D. J., 1994, C-terminal amidated peptides: production by the in vitro enzymatic amidation of glycine-extended peptides and the importance of the amide to bioactivity. Enzyme Microb. Technol., 16, 450-456 |
| Database reference: |