BIOPEP-UWM: Report
| ID | 2920 |
| Name | Precursor of neuropeptide |
| sequence |
| Function: | |||
| Precursor of neuropeptide | |||
| Number of residues | 9 |
Activity code | ne |
| Activity : | neuropeptide |
|||
| Chemical mass | 1067.1949 | Monoisotopic mass | 1066.5543 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Sithigorngul P., Saraithongkum W., Jaideechoey S., Longyant S., Sithigorngul W. | |
| Title | |
| Novel FMRFamide-like neuropeptides from the eyestalk of the giant prawn Macrobrachium rosenbergii. Comp. Biochem. Physiol. B, 120, 587-595 (1998) | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(N)C(=O)N[C@@]([H])(CC(O)=O)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(N)=O)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)NCC(O)=O InChI=1S/C49H74N14O13/c1-27(2)21-33(45(73)58-32(18-12-20-55-49(53)54)44(72)61-34(42(70)56-26-40(67)68)22-29-13-6-4-7-14-29)60-46(74)35(23-30-15-8-5-9-16-30)62-47(75)36(24-38(52)64)63-43(71)31(17-10-11-19-50)57-48(76)37(25-39(65)66)59-41(69)28(3)51/h4-9,13-16,27-28,31-37H,10-12,17-26,50-51H2,1-3H3,(H2,52,64)(H,56,70)(H,57,76)(H,58,73)(H,59,69)(H,60,74)(H,61,72)(H,62,75)(H,63,71)(H,65,66)(H,67,68)(H4,53,54,55)/t28-,31-,32-,33-,34-,35-,36-,37-/m0/s1 InChIKey=FZUQGJRSZGLDRC-RPXHOIECSA-N The active form is C-terminal amide group instead of C-terminal glycine residue. Peptide is the precursor of neuropeptide (ID 2900 in BIOPEP-UWM database of bioactive peptides). Reviews concerning C-terminal amidation of peptides: Bradbury A. F., Smyth D. G., 1991, Peptide amidation. Trends Biochem. Sci., 16, 112-115 Merkler D. J., 1994, C-terminal amidated peptides: production by the in vitro enzymatic amidation of glycine-extended peptides and the importance of the amide to bioactivity. Enzyme Microb. Technol., 16, 450-456 |
| Database reference: |