BIOPEP-UWM: Report
| ID | 3039 |
| Name | Inhibitor of fibrinogen and thrombin coagulation |
| sequence |
| Function: | |||
| Antithrombotic | |||
| Number of residues | 5 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 522.5963 | Monoisotopic mass | 522.2906 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Maruyama S., Nonaka I., Tanaka H. | |
| Title | |
| Inhibitory effects of enzymatic hydrolysates of collagen and collagen-related synthetic peptides on fibrinogen/thrombin clotting. Biochim. Biophys. Acta, 1164, 215-218, 1993 | |
| Year | Source |
| 1993 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CCCNC(N)=N)(NC(=O)[C@]1([H])CCCN1C(=O)CN)C(=O)N1CCC[C@@]1([H])C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C23H38N8O6/c24-13-18(32)29-10-2-6-15(29)19(33)28-14(5-1-9-27-23(25)26)20(34)30-11-3-7-16(30)21(35)31-12-4-8-17(31)22(36)37/h14-17H,1-13,24H2,(H,28,33)(H,36,37)(H4,25,26,27)/t14-,15-,16-,17-/m0/s1 InChIKey=RJJFKAWJIVDUAW-QAETUUGQSA-N |
| Database reference: |
| ChemSpider: ID 8133995 PubChem: CID 9958386 |