BIOPEP-UWM: Report
| ID | 3040 |
| Name | Inhibitor of fibrinogen and thrombin coagulation |
| sequence |
| Function: | |||
| Antithrombotic | |||
| Number of residues | 4 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 385.4177 | Monoisotopic mass | 385.2068 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Maruyama S., Nonaka I., Tanaka H. | |
| Title | |
| Inhibitory effects of enzymatic hydrolysates of collagen and collagen-related synthetic peptides on fibrinogen/thrombin clotting. Biochim. Biophys. Acta, 1164, 215-218, 1993 | |
| Year | Source |
| 1993 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CCCNC(N)=N)(NC(=O)[C@]1([H])CCCN1C(=O)CN)C(=O)NCC(O)=O InChI=1S/C15H27N7O5/c16-7-11(23)22-6-2-4-10(22)14(27)21-9(3-1-5-19-15(17)18)13(26)20-8-12(24)25/h9-10H,1-8,16H2,(H,20,26)(H,21,27)(H,24,25)(H4,17,18,19)/t9-,10-/m0/s1 InChIKey=WQBHKWYLFLZVCN-UWVGGRQHSA-N |
| Database reference: |
| ChemSpider: ID 8628082 PubChem: CID 10452666 |