BIOPEP-UWM: Report
| ID | 3041 |
| Name | inhibitor of fibrinogen and thrombin coagulation |
| sequence |
| Function: | |||
| Antithrombotic | |||
| Number of residues | 5 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 482.5326 | Monoisotopic mass | 482.2594 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Maruyama S., Nonaka I., Tanaka H. | |
| Title | |
| Inhibitory effects of enzymatic hydrolysates of collagen and collagen-related synthetic peptides on fibrinogen/thrombin clotting. Biochim. Biophys. Acta, 1164, 215-218, 1993 | |
| Year | Source |
| 1993 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CCCNC(N)=N)(NC(=O)[C@]1([H])CCCN1C(=O)CN)C(=O)NCC(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C20H34N8O6/c21-10-15(29)27-8-2-5-13(27)18(32)26-12(4-1-7-24-20(22)23)17(31)25-11-16(30)28-9-3-6-14(28)19(33)34/h12-14H,1-11,21H2,(H,25,31)(H,26,32)(H,33,34)(H4,22,23,24)/t12-,13-,14-/m0/s1 InChIKey=QSVOPKLIJBLFDP-IHRRRGAJSA-N |
| Database reference: |
| ChemSpider: ID 8226491 PubChem: CID 10050929 |