BIOPEP-UWM: Report
| ID | 3042 |
| Name | inhibitor of fibrinogen and thrombin coagulation |
| sequence |
| Function: | |||
| Antithrombotic | |||
| Number of residues | 6 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 553.6103 | Monoisotopic mass | 553.2964 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Maruyama S., Nonaka I., Tanaka H. | |
| Title | |
| Inhibitory effects of enzymatic hydrolysates of collagen and collagen-related synthetic peptides on fibrinogen/thrombin clotting. Biochim. Biophys. Acta, 1164, 215-218, 1993 | |
| Year | Source |
| 1993 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(NC(=O)[C@]1([H])CCCN1C(=O)CNC(=O)[C@]([H])(CCCNC(N)=N)NC(=O)[C@]1([H])CCCN1C(=O)CN)C(O)=O InChI=1S/C23H39N9O7/c1-13(22(38)39)29-20(36)15-6-4-10-32(15)18(34)12-28-19(35)14(5-2-8-27-23(25)26)30-21(37)16-7-3-9-31(16)17(33)11-24/h13-16H,2-12,24H2,1H3,(H,28,35)(H,29,36)(H,30,37)(H,38,39)(H4,25,26,27)/t13-,14-,15-,16-/m0/s1 InChIKey=BDLGLGSCJDHZRT-VGWMRTNUSA-N |
| Database reference: |
| PubChem: CID 134826438 |