BIOPEP-UWM: Report
| ID | 3043 |
| Name | inhibitor of fibrinogen and thrombin coagulation |
| sequence |
| Function: | |||
| Number of residues | 4 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 425.4814 | Monoisotopic mass | 425.2380 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Maruyama S., Nonaka I., Tanaka H. | |
| Title | |
| Inhibitory effects of enzymatic hydrolysates of collagen and collagen-related synthetic peptides on fibrinogen/thrombin clotting. Biochim. Biophys. Acta, 1164, 215-218 | |
| Year | Source |
| 1993 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CCCNC(N)=N)(NC(=O)[C@]1([H])CCCN1C(=O)CN)C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C18H31N7O5/c19-10-14(26)24-8-2-5-12(24)15(27)23-11(4-1-7-22-18(20)21)16(28)25-9-3-6-13(25)17(29)30/h11-13H,1-10,19H2,(H,23,27)(H,29,30)(H4,20,21,22)/t11-,12-,13-/m0/s1 InChIKey=WXPZDDCNKXMOMC-AVGNSLFASA-N |
| Database reference: |