BIOPEP-UWM: Report
| ID | 3044 |
| Name | Antithrombotic peptide |
| sequence |
| Function: | |||
| antithrombotic | |||
| Number of residues | 6 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 579.6475 | Monoisotopic mass | 579.3120 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Maruyama S., Nonaka I., Tanaka H. | |
| Title | |
| Inhibitory effects of enzymatic hydrolysates of collagen and collagen-related synthetic peptides on fibrinogen/thrombin clotting. Biochim. Biophys. Acta, 1164, 215-218, 1993 | |
| Year | Source |
| 1993 | Journal |
| Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CCCNC(N)=N)(NC(=O)[C@]1([H])CCCN1C(=O)CN)C(=O)NCC(=O)N1CCC[C@@]1([H])C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C25H41N9O7/c26-13-19(35)32-10-2-6-16(32)22(38)31-15(5-1-9-29-25(27)28)21(37)30-14-20(36)33-11-3-7-17(33)23(39)34-12-4-8-18(34)24(40)41/h15-18H,1-14,26H2,(H,30,37)(H,31,38)(H,40,41)(H4,27,28,29)/t15-,16-,17-,18-/m0/s1 InChIKey=OFTCAPRHKMGJER-XSLAGTTESA-N |
| Database reference: |
| PubChem: CID 134826439 |