BIOPEP-UWM: Report
| ID | 3047 |
| Name | Antithrombotic peptide |
| sequence |
| Function: | |||
| antithrombotic | |||
| Number of residues | 3 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 328.3665 | Monoisotopic mass | 328.1854 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Maruyama S., Nonaka I., Tanaka H. | |
| Title | |
| Inhibitory effects of enzymatic hydrolysates of collagen and collagen-related synthetic peptides on fibrinogen/thrombin clotting. Biochim. Biophys. Acta prot. Struct. Mol. Enzymol., 1164, 215-218, 1993 | |
| Year | Source |
| 1993 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CCCNC(N)=N)(NC(=O)[C@]1([H])CCCN1C(=O)CN)C(O)=O InChI=1S/C13H24N6O4/c14-7-10(20)19-6-2-4-9(19)11(21)18-8(12(22)23)3-1-5-17-13(15)16/h8-9H,1-7,14H2,(H,18,21)(H,22,23)(H4,15,16,17)/t8-,9-/m0/s1 InChIKey=JYPCXBJRLBHWME-IUCAKERBSA-N Neuroprotective peptide according to the ChEMBL database Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the EROP-Moscow database Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database |
| Database reference: |
| ACToR: ID 47295-77-2 AHTPDB: ID 2713, 6120 BioPepDB: ID biopep00397 BIOPEP-UWM database of sensory peptides and amino acids: ID 341 BRENDA: Ligand Gly-Pro-Arg CAS: Registry No 47295-77-2 ChEBI: ID 163949 ChEMBL: ID CHEMBL3752079 ChemIDplus: ID 47295-77-2 ChemSpider: ID 149304 DFBP: ID DFBPACEI1250; DFBPANTH0014, DFBPANTH0064, DFBPANTH0075, DFBPANTH0076, DFBPANTH0079; DFBPMUFU0276 EPA CompTox: ID DTXSID00197085 EROP-Moscow: ID E09224 J-GLOBAL: ID 200907014849104358 Metabolomics Workbench: ID 82137 MMDB: ID 21849.7 Nikkaji: ID J378.769I PubChem: CID 170776 SATPdb: ID satpdb26650 SureChEMBL: ID SCHEMBL7853147 Wikidata: ID Q83070056 ZINC: ID ZINC02572698 |