BIOPEP-UWM: Report
| ID | 3054 |
| Name | Thymopentin |
| sequence |
| Function: | |||
| Immunostimulating | |||
| Number of residues | 5 |
Activity code | is |
| Activity : | immunostimulating |
|||
| Chemical mass | 679.7630 | Monoisotopic mass | 679.3642 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Audhya T., Scheid M. P., Goldstein G. | |
| Title | |
| Contrasting biological activities of thymopoietin and splenin, two closely related polypeptide products of thymus and spleen. Proc. Natl Acad. Sci. USA, 81, 2847-2849, 1984 | |
| Year | Source |
| 1984 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCNC(N)=N)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(O)=O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(O)=O InChI=1S/C30H49N9O9/c1-16(2)24(28(46)38-22(29(47)48)14-17-8-10-18(40)11-9-17)39-27(45)21(15-23(41)42)37-26(44)20(7-3-4-12-31)36-25(43)19(32)6-5-13-35-30(33)34/h8-11,16,19-22,24,40H,3-7,12-15,31-32H2,1-2H3,(H,36,43)(H,37,44)(H,38,46)(H,39,45)(H,41,42)(H,47,48)(H4,33,34,35)/t19-,20-,21-,22-,24-/m0/s1 InChIKey=PSWFFKRAVBDQEG-YGQNSOCVSA-N |
| Database reference: |
| ACToR: ID 69558-55-0 BRENDA: Ligand thymopentin ChEBI: ID 135870 ChEMBL: ID CHEMBL156025 ChemSpider: ID 397640 DrugBank: ID DB11996 DrugCentral: ID 2645 EPA CompTox: ID DTXSID9046609 EPA DSSTox: ID DTXCID7026609 J-GLOBAL: ID 200907067075113622 KEGG: ID D06117 NIAID: ID 000127 Nikkaji: ID J128.629C PepBank: Peptide RKDVY PepLife: ID 3093 PubChem: CID 451417 |