BIOPEP-UWM: Report
| ID | 3065 |
| Name | fragment of bovine beta-casein 191-193 |
| sequence |
| Function: | |||
| Immunostimulating | |||
| Number of residues | 3 |
Activity code | is |
| Activity : | immunostimulating |
|||
| Chemical mass | 407.5025 | Monoisotopic mass | 407.2412 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Berthou J., Migliore-Samour D., Lifchitz A., Delettre J., Floc'h F., Jolles P. | |
| Title | |
| Immunostimulating properties and three-dimensional structure of two tripeptides from human and cow caseins. FEBS Lett., 146, 79-87, 1987 | |
| Year | Source |
| 1987 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(O)=O InChI=1S/C21H33N3O5/c1-12(2)9-16(22)19(26)23-17(10-13(3)4)20(27)24-18(21(28)29)11-14-5-7-15(25)8-6-14/h5-8,12-13,16-18,25H,9-11,22H2,1-4H3,(H,23,26)(H,24,27)(H,28,29)/t16-,17-,18-/m0/s1 InChIKey=UCNNZELZXFXXJQ-BZSNNMDCSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides (ID 10167); the MBPDB database Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides (ID 10168); the MBPDB database Antiviral peptide according to the BIOPEP-UWM Virtual database (ID 57) |
| Database reference: |
| ACToR: ID 20368-24-5 BIOPEP-UWM database of bioactive peptides: ID 10167; 10168 BIOPEP-UWM Virtual database: ID 57 BRENDA: Ligand Leu-Leu-Tyr ChEBI: ID 6415 ChemIDplus: ID 20368-24-5 ChemSpider: ID 79864 CTD: ID 20368-24-5 EROP-Moscow: ID E01884 FeptideDB: ID 3065 J-GLOBAL: ID 200907096522740788 KEGG: ID C11331 MBPDB: Peptide LLY Nikkaji: ID J492.339A PubChem: CID 88513 |