BIOPEP-UWM: Report
| ID | 3095 |
| Name | Splenopentin |
| sequence |
| Function: | |||
| Immunomodulating | |||
| Number of residues | 5 |
Activity code | im |
| Activity : | immunomodulating |
|||
| Chemical mass | 693.7895 | Monoisotopic mass | 693.3798 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Audhya T., Scheid M. P., Goldstein G. | |
| Title | |
| Contrasting biological activities of thymopoietin and splenin, two closely related polypeptide products of thymus and spleen. Proc. Natl Acad. Sci. USA, 81, 2847-2849, 1984 | |
| Year | Source |
| 1984 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCNC(N)=N)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCC(O)=O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(O)=O InChI=1S/C31H51N9O9/c1-17(2)25(29(47)39-23(30(48)49)16-18-8-10-19(41)11-9-18)40-28(46)22(12-13-24(42)43)38-27(45)21(7-3-4-14-32)37-26(44)20(33)6-5-15-36-31(34)35/h8-11,17,20-23,25,41H,3-7,12-16,32-33H2,1-2H3,(H,37,44)(H,38,45)(H,39,47)(H,40,46)(H,42,43)(H,48,49)(H4,34,35,36)/t20-,21-,22-,23-,25-/m0/s1 InChIKey=DRCNRVYVCHHIJP-AQBORDMYSA-N |
| Database reference: |
| ACToR: ID 75957-60-7 ChemIDplus: ID 75957-60-7 ChemSpider: ID 108693 CTD: ID 75957-60-7 J-GLOBAL: ID 200907000484097658 Nikkaji: ID J366.269A PubChem: CID 121827 |