BIOPEP-UWM: Report
ID | 3098 |
Name | fragment of bovine beta casein (91-93) |
sequence |
Function: | |||
Immunostimulating | |||
Number of residues | 3 |
Activity code | is |
Activity : | immunostimulating |
|||
Chemical mass | 305.3939 | Monoisotopic mass | 305.1404 | |
EC50 : | 0.00 µM |
Bibliographic data: | |
Authors | |
Xu R. J. | |
Title | |
Bioactive peptides in milk and their biological and health implications. Food. Rev. Int. 14(1), 1-16, 1998 | |
Year | Source |
1998 | Journal |
Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CCSC)(NC(=O)[C@@]([H])(NC(=O)CN)C(C)C)C(O)=O InChI=1S/C12H23N3O4S/c1-7(2)10(15-9(16)6-13)11(17)14-8(12(18)19)4-5-20-3/h7-8,10H,4-6,13H2,1-3H3,(H,14,17)(H,15,16)(H,18,19)/t8-,10-/m0/s1 InChIKey=MUGLKCQHTUFLGF-WPRPVWTQSA-N |
Database reference: |