BIOPEP-UWM: Report
| ID | 3101 |
| Name | beta-amyloid protein fragment:25-35 |
| sequence |
| Function: | |||
| Beta-amyloid is a fragment of a protein that is snipped from another protein called amyloid precursor protein (APP). In a healthy brain, these protein fragments would be broken down and eliminated. In Alzheimer’s disease, the fragments accumulate to form hard, insoluble plaques. | |||
| Number of residues | 11 |
Activity code | ne |
| Activity : | neuropeptide |
|||
| Chemical mass | 1060.2662 | Monoisotopic mass | 1059.5728 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Castaño J. M., Ghiso J., Prelli F., Gorevic P. D., Migheli A., Frangione B. | |
| Title | |
| In vitro formation of amyloid fibrils from two synthetic peptides of different lengths homologous to Alzheimer's disease beta-protein. Biochem. Biophys. Res. Commun., 141, 782-789, 1986 | |
| Year | Source |
| 1986 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(NC(=O)CNC(=O)[C@]([H])(CCCCN)NC(=O)[C@]([H])(CC(N)=O)NC(=O)[C@]([H])(CO)NC(=O)CN)C(=O)N[C@@]([H])([C@@H](C)CC)C(=O)N[C@@]([H])([C@@H](C)CC)C(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCSC)C(O)=O InChI=1S/C45H81N13O14S/c1-9-24(5)36(43(69)50-21-35(63)52-29(17-23(3)4)40(66)55-28(45(71)72)14-16-73-8)58-44(70)37(25(6)10-2)57-38(64)26(7)51-34(62)20-49-39(65)27(13-11-12-15-46)54-41(67)30(18-32(48)60)56-42(68)31(22-59)53-33(61)19-47/h23-31,36-37,59H,9-22,46-47H2,1-8H3,(H2,48,60)(H,49,65)(H,50,69)(H,51,62)(H,52,63)(H,53,61)(H,54,67)(H,55,66)(H,56,68)(H,57,64)(H,58,70)(H,71,72)/t24-,25-,26-,27-,28-,29-,30-,31-,36-,37-/m0/s1 InChIKey=WIHBNMPFWRHGDF-SLVFWPMISA-N |
| Database reference: |
| PubChem: CID 10843733 |