BIOPEP-UWM: Report
| ID | 3105 |
| Name | fragment of anafylatoxin C3a: 70-77 |
| sequence |
| Function: | |||
| Smooth muscles contracting | |||
| Number of residues | 8 |
Activity code | con |
| Activity : | contracting |
|||
| Chemical mass | 823.9375 | Monoisotopic mass | 823.4651 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Hugli T. E., Erickson B. W. | |
| Title | |
| Synthetic peptides with the biological activities and specificity of human C3a anaphylatoxin. Proc. Natl. Acad. Sci. USA, 74, 1826-1830, 1977 | |
| Year | Source |
| 1977 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [C@@H](C)(N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC1=CN=C[N]1)C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O InChI=1S/C35H61N13O10/c1-17(2)10-23(46-32(55)25(12-21-13-39-16-42-21)47-33(56)26(15-49)48-28(51)19(5)36)30(53)41-14-27(50)44-24(11-18(3)4)31(54)43-20(6)29(52)45-22(34(57)58)8-7-9-40-35(37)38/h13,16-20,22-26,49H,7-12,14-15,36H2,1-6H3,(H,39,42)(H,41,53)(H,43,54)(H,44,50)(H,45,52)(H,46,55)(H,47,56)(H,48,51)(H,57,58)(H4,37,38,40)/t19-,20-,22-,23-,24-,25-,26-/m0/s1 InChIKey=LYTNSBOBASKUDN-GUQPKPMOSA-N |
| Database reference: |