BIOPEP-UWM: Report
| ID | 3115 |
| Name | adrenocorticotropin hormone fr.: 1-14 |
| sequence |
| Function: | |||
| ACTH is produced due to stress, in the form of physical, emotional, or dietary, signals the brain. ACTH turns signals the adrenal glands to produce cortisol that regulates glucose levels in the blood and activates immune response to foreign invaders such as viruses and bacteria. | |||
| Number of residues | 14 |
Activity code | re |
| Activity : | regulating |
|||
| Chemical mass | 1680.8798 | Monoisotopic mass | 1679.7854 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gao X. F., Wong T. C. | |
| Title | |
| NMR studies of adrenocorticotropin hormone peptides in sodium dodecylsulfate and dodecylphosphocholine micelles: proline isomerism and interactions of the peptides with micelles. Biopolymers, 58, 20-32, 2001 | |
| Year | Source |
| 2001 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [C@H](N)(CO)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC2=CN=C[N]2)C(=O)N[C@@H](CC3=CC=CC=C3)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC4=C[N]C5=C4C=CC=C5)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N6CCC[C@H]6C(=O)N[C@@H](C(C)C)C(=O)NCC(O)=O InChI=1S/C77H109N21O20S/c1-42(2)64(75(117)86-38-63(105)106)97-74(116)60-19-12-29-98(60)76(118)54(17-9-10-27-78)88-61(102)37-85-66(108)57(33-45-35-84-50-16-8-7-15-48(45)50)94-67(109)51(18-11-28-83-77(80)81)89-70(112)56(31-43-13-5-4-6-14-43)93-72(114)58(34-46-36-82-41-87-46)95-68(110)52(24-25-62(103)104)90-69(111)53(26-30-119-3)91-73(115)59(40-100)96-71(113)55(92-65(107)49(79)39-99)32-44-20-22-47(101)23-21-44/h4-8,13-16,20-23,35-36,41-42,49,51-60,64,84,99-101H,9-12,17-19,24-34,37-40,78-79H2,1-3H3,(H,82,87)(H,85,108)(H,86,117)(H,88,102)(H,89,112)(H,90,111)(H,91,115)(H,92,107)(H,93,114)(H,94,109)(H,95,110)(H,96,113)(H,97,116)(H,103,104)(H,105,106)(H4,80,81,83)/t49-,51-,52-,53-,54-,55-,56-,57-,58-,59-,60-,64-/m0/s1 InChIKey=WKVUCFHTERJJRV-MSKBXMOCSA-N |
| Database reference: |
| ChemSpider: ID 17288861 J-GLOBAL: ID 200907073490641170 Nikkaji: ID J1.898.134C PubChem: CID 90470612 |