BIOPEP-UWM: Report
| ID | 3124 |
| Name | alpha1-chain of collagen fr.: 430-438 |
| sequence |
| Function: | |||
| antithrombotic | |||
| Number of residues | 13 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 1114.1208 | Monoisotopic mass | 1113.5034 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Barnes M. J., Knight C. G., Farndale R. W. | |
| Title | |
| The use of collagen-based model peptides to investigate platelet-reactive sequences in collagen. Biopolymers 40, 383-397 (1996) | |
| Year | Source |
| 1996 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(NC(=O)CNC(=O)[C@]([H])(C)NC(=O)[C@]([H])(CCC(O)=O)NC(=O)CNC(=O)[C@]([H])(CC(O)=O)NC(=O)[C@]([H])(CCCCN)NC(=O)CNC(=O)[C@]([H])(C)NC(=O)[C@]1([H])CCCN1C(=O)CN)C(=O)N[C@@]([H])(CCC(N)=O)C(=O)NCC(O)=O InChI=1S/C44H71N15O19/c1-21(37(71)48-17-30(61)52-23(3)39(73)57-25(9-11-29(47)60)40(74)51-20-36(69)70)53-42(76)26(10-12-34(65)66)56-32(63)19-50-41(75)27(15-35(67)68)58-43(77)24(7-4-5-13-45)55-31(62)18-49-38(72)22(2)54-44(78)28-8-6-14-59(28)33(64)16-46/h21-28H,4-20,45-46H2,1-3H3,(H2,47,60)(H,48,71)(H,49,72)(H,50,75)(H,51,74)(H,52,61)(H,53,76)(H,54,78)(H,55,62)(H,56,63)(H,57,73)(H,58,77)(H,65,66)(H,67,68)(H,69,70)/t21-,22-,23-,24-,25-,26-,27-,28-/m0/s1 InChIKey=GHGUCAWATVFUMM-VXBMVYAYSA-N |
| Database reference: |