BIOPEP-UWM: Report
| ID | 3125 |
| Name | fibronectin inhibitor |
| sequence |
| Function: | |||
| Antithrombotic | |||
| Number of residues | 10 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 1001.0494 | Monoisotopic mass | 1000.4922 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Pierschbacher M. D., Ruoslahti E. | |
| Title | |
| Cell attachment activity of fibronectin can be duplicated by small synthetic fragment of the molecule. Nature, 309, 30-33, 1984 | |
| Year | Source |
| 1984 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCNC(N)=N)C(=O)NCC(=O)N[C@@]([H])(CC(O)=O)C(=O)N[C@@]([H])(CO)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCCCN)C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C40H68N14O16/c1-20(31(61)50-24(17-55)35(65)51-25(18-56)34(64)49-22(8-2-3-11-41)37(67)54-14-6-10-28(54)39(69)70)47-36(66)27-9-5-13-53(27)38(68)26(19-57)52-33(63)23(15-30(59)60)48-29(58)16-46-32(62)21(42)7-4-12-45-40(43)44/h20-28,55-57H,2-19,41-42H2,1H3,(H,46,62)(H,47,66)(H,48,58)(H,49,64)(H,50,61)(H,51,65)(H,52,63)(H,59,60)(H,69,70)(H4,43,44,45)/t20-,21-,22-,23-,24-,25-,26-,27-,28-/m0/s1 InChIKey=JMBLPSUDFRAOLU-SMNCUOCCSA-N |
| Database reference: |
| ChemSpider: ID 8410581 J-GLOBAL: ID 200907091504656891 Nikkaji: ID J1.232.481B PepBank: Peptide RGDSPASSKP PubChem: CID 10235093 |