BIOPEP-UWM: Report
ID | 3163 |
Name | entherostatin |
sequence |
Function: | |||
Satiety signaling | |||
Number of residues | 5 |
Activity code | an |
Activity : | anorectic |
|||
Chemical mass | 496.5591 | Monoisotopic mass | 496.2750 | |
EC50 : | 0.00 µM |
Bibliographic data: | |
Authors | |
Ashmarin I. P., Karazeeva E. P., Lyapina L. A., Samonina G. E. | |
Title | |
The simplest proline-containing peptides PG, GP, PGP and GPGG: regulatory activity and possible source of biosynthesis. Biochemistry-Moscow, 63, 119-124, 1998 | |
Year | Source |
1998 | Journal |
Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(N)C(=O)N1CCC[C@@]1([H])C(=O)NCC(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CCCNC(N)=N)C(O)=O InChI=1S/C21H36N8O6/c1-12(22)19(33)29-10-4-6-14(29)17(31)26-11-16(30)28-9-3-7-15(28)18(32)27-13(20(34)35)5-2-8-25-21(23)24/h12-15H,2-11,22H2,1H3,(H,26,31)(H,27,32)(H,34,35)(H4,23,24,25)/t12-,13-,14-,15-/m0/s1 InChIKey=ITZMJCSORYKOSI-AJNGGQMLSA-N |
Database reference: |
ACToR: ID 117830-79-2 ChemIDplus: ID 117830-79-2 ChEBI: ID 89430 ChemSpider: ID 2340236 eChemPortal: ID 117830-79-2 EPA CompTox: ID DTXSID20151927 EPA DSSTox: ID DTXCID1074418 EROP-Moscow: ID E14469 FooDB: ID FDB023831 HMDB: ID HMDB06117 J-GLOBAL: ID 200907025250229510 NeuroPep: ID NP04049 Nikkaji: ID J1.031.757F PepBank: peptide APGPR PepLife: ID 2916; 2917 PubChem: CID 3082883 |