BIOPEP-UWM: Report
| ID | 3164 |
| Name | laminin-like peptide |
| sequence |
| Function: | |||
| Embryotoxic | |||
| Number of residues | 3 |
Activity code | emb |
| Activity : | embryotoxic |
|||
| Chemical mass | 346.3388 | Monoisotopic mass | 346.1596 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chambers B. J., Klein N. W., Conrad S. H., Ruppenthal G. C., Sackett G. P., Weeks B. S., Kleinman H. K. | |
| Title | |
| Reproduction and sera embryotoxicity after immunization of monkeys with the laminin peptides YIGSR, RGD and IKVAV. Proc. Natl Acad Sci. USA, 92, 6818-6822, 1995 | |
| Year | Source |
| 1995 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCNC(N)=N)C(=O)NCC(=O)N[C@@]([H])(CC(O)=O)C(O)=O InChI=1S/C12H22N6O6/c13-6(2-1-3-16-12(14)15)10(22)17-5-8(19)18-7(11(23)24)4-9(20)21/h6-7H,1-5,13H2,(H,17,22)(H,18,19)(H,20,21)(H,23,24)(H4,14,15,16)/t6-,7-/m0/s1 InChIKey=IYMAXBFPHPZYIK-BQBZGAKWSA-N Antithrombotic peptide according to the BIOPEP-UWM database of bioactive peptides (ID 9660); the ChEMBL database |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCNC(N)=N)C(=O)NCC(=O)N[C@@]([H])(CC(O)=O)C(O)=O InChI=1S/C12H22N6O6/c13-6(2-1-3-16-12(14)15)10(22)17-5-8(19)18-7(11(23)24)4-9(20)21/h6-7H,1-5,13H2,(H,17,22)(H,18,19)(H,20,21)(H,23,24)(H4,14,15,16)/t6-,7-/m0/s1 InChIKey=IYMAXBFPHPZYIK-BQBZGAKWSA-N Antithrombotic peptide according to the BIOPEP-UWM database of bioactive peptides (ID 9660); the ChEMBL database |