BIOPEP-UWM: Report
| ID | 3165 |
| Name | laminin-like peptide |
| sequence |
| Function: | |||
| Embryotoxic | |||
| Number of residues | 5 |
Activity code | emb |
| Activity : | embryotoxic |
|||
| Chemical mass | 594.6588 | Monoisotopic mass | 594.3116 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chambers B. J., Klein N. W., Conrad S. H., Ruppenthal G. C., Sackett G. P., Weeks B. S., Kleinman H. K. | |
| Title | |
| Reproduction and sera embryotoxicity after immunization of monkeys with the laminin peptides YIGSR, RGD and IKVAV. Proc. Natl Acad Sci. USA, 92, 6818-6822, 1995 | |
| Year | Source |
| 1995 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C26H42N8O8/c1-3-14(2)21(34-22(38)17(27)11-15-6-8-16(36)9-7-15)24(40)31-12-20(37)32-19(13-35)23(39)33-18(25(41)42)5-4-10-30-26(28)29/h6-9,14,17-19,21,35-36H,3-5,10-13,27H2,1-2H3,(H,31,40)(H,32,37)(H,33,39)(H,34,38)(H,41,42)(H4,28,29,30)/t14-,17-,18-,19-,21-/m0/s1 InChIKey=MWOGMBZGFFZBMK-LJZWMIMPSA-N Anticancer peptide according to the BIOPEP-UWM database of bioactive peptides (ID 3427) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 3427 ChemIDplus: ID 110590-64-2 ChemSpider: ID 110496 PepBank: Peptide YIGSR PubChem: CID 123977 |