BIOPEP-UWM: Report
| ID | 3168 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 4 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 406.4748 | Monoisotopic mass | 406.2209 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Harada M., Fukasawa K. M., Fukasawa K., Nagatsu T. | |
| Title | |
| Inhibitory action of proline-containing peptides on Xaa-Pro-dipeptidylaminopeptidase. Biochim. Biophys. Acta, 705, 288-290 | |
| Year | Source |
| 1982 | Journal |
| Additional information: |
| BIOPEP database of bioactive peptides SMILES: N1[C@H](C(=O)N2[C@H](C(=O)N3[C@H](C(=O)N4[C@H](C(=O)O)CCC4)CCC3)CCC2)CCC1 InChI=1S/C20H30N4O5/c25-17(13-5-1-9-21-13)22-10-2-6-14(22)18(26)23-11-3-7-15(23)19(27)24-12-4-8-16(24)20(28)29/h13-16,21H,1-12H2,(H,28,29)/t13-,14-,15-,16-/m0/s1 InChIKey: CBNLHHITRUAXOE-VGWMRTNUSA-N |
| Database reference: |
| ChemSpider: ID 10077305 PubChem: ID 11902982 ZINC: ID ZINC04899797 |