BIOPEP-UWM: Report
| ID | 3171 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 246.3269 | Monoisotopic mass | 246.1034 | |
| EC50 : | 870.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Hatanaka T., Inoue Y., Arima J., Kumagai Y., Usuki H., Kawakami K., Kimura M., Mukaihara T. | |
| Title | |
| Production of dipeptidyl peptidase IV inhibitory peptides from defatted rice bran. Food Chem., 134, 797-802 | |
| Year | Source |
| 2012 | Journal |
| Additional information: |
| BIOPEP database of bioactive peptides SMILES: N[C@H](C(=O)N1[C@H](C(=O)O)CCC1)CCSC InChI=1S/C10H18N2O3S/c1-16-6-4-7(11)9(13)12-5-2-3-8(12)10(14)15/h7-8H,2-6,11H2,1H3,(H,14,15)/t7-,8-/m0/s1 InChIKey: DZMGFGQBRYWJOR-YUMQZZPRSA-N First reference concerning peptide: Bella A. M., Erickson R. H. Jr., Kim Y. S. Rat intestinal brush border membrane dipeptidyl-aminopeptidase IV: kinetic properties and substrate specifities of the purified enzyme. Arch. Biochem. Biophys. 218 (1), 156-162(1982) Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: XM02-001) according to the AHTPDB database |
| Database reference: |
| AHTPDB: ID 6968 BRENDA: Ligand Met-Pro ChEBI: ID 73612 ChemSpider: ID 10067894 EPA DSSTox: ID DTXCID40425354 EROP-Moscow: ID E09230 PubChem: CID 11893571 SATPdb: ID satpdb28809 ZINC: ID ZINC04556855 |