BIOPEP-UWM: Report
| ID | 3173 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 220.2897 | Monoisotopic mass | 220.0878 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Bella A. M., Erickson R. H. Jr., Kim Y. S. | |
| Title | |
| Rat intestinal brush border membrane dipeptidyl-aminopeptidase IV: kinetic properties and substrate specifities of the purified enzyme. Arch. Biochem. Biophys. 218 (1), 156-162 (1982)) | |
| Year | Source |
| 1982 | Journal |
| Additional information: |
| BIOPEP database of bioactive peptides SMILES: N[C@@H](CCSC)C(=O)N[C@@H](C)C(=O)O InChI=1S/C8H16N2O3S/c1-5(8(12)13)10-7(11)6(9)3-4-14-2/h5-6H,3-4,9H2,1-2H3,(H,10,11)(H,12,13)/t5-,6-/m0/s1 InChIKey: JHKXZYLNVJRAAJ-WDSKDSINSA-N Inhibitor of citrulline uptake in yeasts according to the ChEMBL database Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: XM02-001) according to the AHTPDB database; the EROP-Moscow database |
| Database reference: |
| AHTPDB: ID 6969 BRENDA: Ligand Met-Ala ChEBI: ID 73610 ChEMBL: ID CHEMBL1222161 ChemSpider: ID 5373160 EROP-Moscow: ID E09229 J-GLOBAL: ID 200907081200481119 Nikkaji: ID J149.659J PubChem: ID 7009581 SATPdb: ID satpdb16151 SureChEMBL: ID SCHEMBL2875974 ZINC: ID ZINC02384801 |