BIOPEP-UWM: Report
| ID | 3179 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 186.2078 | Monoisotopic mass | 186.1001 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Bella A. M., Erickson R. H. Jr., Kim Y. S. | |
| Title | |
| Rat intestinal brush border membrane dipeptidyl-aminopeptidase IV:kinetic properties and substrate specifities of the purified enzyme.Arch.Biochem.Biophys. 218 (1), 156-162 (1982) | |
| Year | Source |
| 1982 | Journal |
| Additional information: |
| Additional information: BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(NC(=O)[C@]1([H])CCCN1)C(O)=O InChI=1S/C8H14N2O3/c1-5(8(12)13)10-7(11)6-3-2-4-9-6/h5-6,9H,2-4H2,1H3,(H,10,11)(H,12,13)/t5-,6-/m0/s1 InChIKey=FELJDCNGZFDUNR-WDSKDSINSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides Bitter peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 472) |
| Database reference: |
| AHTPDB: ID 3871 BIOPEP-UWM database of sensory peptides and amino acids: ID 472 BRENDA: Ligand Pro-Ala CAS: Registry No 6422-36-2 ChEBI: ID 74753 ChEMBL: ID CHEMBL293555 ChemSpider: ID 4894114 EROP-Moscow: ID E09231 FooDB: ID FDB112026 HMDB: ID HMDB0029010 J-GLOBAL: ID 200907046022308050 Metabolomics Workbench: ID 78936 Nikkaji: ID J149.647F PubChem: ID 6347578 SATPdb: ID satpdb21841 SureChEMBL: ID SCHEMBL2841482 Wikidata: ID Q27144880 ZINC: ID ZINC04038298 |